C14H10ClNO2 — CID 92965984
(R)-(5-chloro-1,3-benzoxazol-2-yl)-phenylmethanol (PubChem CID 92965984) has the molecular formula C14H10ClNO2 and a molecular weight of 259.69 g/mol. Its IUPAC name is (R)-(5-chloro-1,3-benzoxazol-2-yl)-phenylmethanol.
| Compound Name | (R)-(5-chloro-1,3-benzoxazol-2-yl)-phenylmethanol |
|---|---|
| PubChem CID | 92965984 |
| Molecular Formula | C14H10ClNO2 |
| Molecular Weight | 259.69 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | (R)-(5-chloro-1,3-benzoxazol-2-yl)-phenylmethanol |
| SMILES | O[C@H](c1ccccc1)c1nc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C14H10ClNO2/c15-10-6-7-12-11(8-10)16-14(18-12)13(17)9-4-2-1-3-5-9/h1-8,13,17H/t13-/m1/s1 |
| InChIKey | YIEURHGSXLGCMZ-CYBMUJFWSA-N |
| XLogP | 3.56 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.69 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |