C8H6ClNO — CID 29510
5-chloro-2-methyl-1,3-benzoxazole (PubChem CID 29510) has the molecular formula C8H6ClNO and a molecular weight of 167.59 g/mol. Its IUPAC name is 5-chloro-2-methyl-1,3-benzoxazole.
| Compound Name | 5-chloro-2-methyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 29510 |
| Molecular Formula | C8H6ClNO |
| Molecular Weight | 167.59 g/mol |
| Exact Mass | 167.01 |
| IUPAC Name | 5-chloro-2-methyl-1,3-benzoxazole |
| SMILES | Cc1nc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C8H6ClNO/c1-5-10-7-4-6(9)2-3-8(7)11-5/h2-4H,1H3 |
| InChIKey | HJCIGAUHTJBHBQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.59 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |