C14H10Cl2N2O3S — CID 69227449
2,4-dichloro-N-(2-methyl-1,3-benzoxazol-5-yl)benzenesulfonamide (PubChem CID 69227449) has the molecular formula C14H10Cl2N2O3S and a molecular weight of 357.22 g/mol. Its IUPAC name is 2,4-dichloro-N-(2-methyl-1,3-benzoxazol-5-yl)benzenesulfonamide.
| Compound Name | 2,4-dichloro-N-(2-methyl-1,3-benzoxazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 69227449 |
| Molecular Formula | C14H10Cl2N2O3S |
| Molecular Weight | 357.22 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | 2,4-dichloro-N-(2-methyl-1,3-benzoxazol-5-yl)benzenesulfonamide |
| SMILES | Cc1nc2cc(NS(=O)(=O)c3ccc(Cl)cc3Cl)ccc2o1 |
| InChI | InChI=1S/C14H10Cl2N2O3S/c1-8-17-12-7-10(3-4-13(12)21-8)18-22(19,20)14-5-2-9(15)6-11(14)16/h2-7,18H,1H3 |
| InChIKey | RUMRTRHHVOUBHK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.22 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |