C10H10ClNOS — CID 11310720
5-chloro-2-propan-2-ylsulfanyl-1,3-benzoxazole (PubChem CID 11310720) has the molecular formula C10H10ClNOS and a molecular weight of 227.72 g/mol. Its IUPAC name is 5-chloro-2-propan-2-ylsulfanyl-1,3-benzoxazole.
| Compound Name | 5-chloro-2-propan-2-ylsulfanyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 11310720 |
| Molecular Formula | C10H10ClNOS |
| Molecular Weight | 227.72 g/mol |
| Exact Mass | 227.02 |
| IUPAC Name | 5-chloro-2-propan-2-ylsulfanyl-1,3-benzoxazole |
| SMILES | CC(C)Sc1nc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C10H10ClNOS/c1-6(2)14-10-12-8-5-7(11)3-4-9(8)13-10/h3-6H,1-2H3 |
| InChIKey | JUFWZZUKTBSZPV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.72 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |