C10H9ClN2O2S — CID 7963456
(2R)-2-[(6-chloro-1,3-benzoxazol-2-yl)sulfanyl]propanamide (PubChem CID 7963456) has the molecular formula C10H9ClN2O2S and a molecular weight of 256.71 g/mol. Its IUPAC name is (2R)-2-[(6-chloro-1,3-benzoxazol-2-yl)sulfanyl]propanamide.
| Compound Name | (2R)-2-[(6-chloro-1,3-benzoxazol-2-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 7963456 |
| Molecular Formula | C10H9ClN2O2S |
| Molecular Weight | 256.71 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | (2R)-2-[(6-chloro-1,3-benzoxazol-2-yl)sulfanyl]propanamide |
| SMILES | C[C@@H](Sc1nc2ccc(Cl)cc2o1)C(N)=O |
| InChI | InChI=1S/C10H9ClN2O2S/c1-5(9(12)14)16-10-13-7-3-2-6(11)4-8(7)15-10/h2-5H,1H3,(H2,12,14)/t5-/m1/s1 |
| InChIKey | XEQHLLVUHYCQNO-RXMQYKEDSA-N |
| XLogP | 2.45 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.71 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |