About N'-(5-chloro-1,3-benzoxazol-2-yl)-N'-methylethane-1,2-diamine
N'-(5-chloro-1,3-benzoxazol-2-yl)-N'-methylethane-1,2-diamine (PubChem CID 83839740) has the molecular formula C10H12ClN3O
and a molecular weight of 225.68 g/mol. Its IUPAC name is N'-(5-chloro-1,3-benzoxazol-2-yl)-N'-methylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(5-chloro-1,3-benzoxazol-2-yl)-N'-methylethane-1,2-diamine |
| PubChem CID | 83839740 |
| Molecular Formula | C10H12ClN3O |
| Molecular Weight | 225.68 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | N'-(5-chloro-1,3-benzoxazol-2-yl)-N'-methylethane-1,2-diamine |
| SMILES | CN(CCN)c1nc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C10H12ClN3O/c1-14(5-4-12)10-13-8-6-7(11)2-3-9(8)15-10/h2-3,6H,4-5,12H2,1H3 |
| InChIKey | FJDNYAHTMBAGRK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.68 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-(5-chloro-1,3-benzoxazol-2-yl)-N'-methylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(5-chloro-1,3-benzoxazol-2-yl)-N'-methylethane-1,2-diamine?
The IUPAC name of N'-(5-chloro-1,3-benzoxazol-2-yl)-N'-methylethane-1,2-diamine (CID 83839740) is N'-(5-chloro-1,3-benzoxazol-2-yl)-N'-methylethane-1,2-diamine.
What is the SMILES notation for N'-(5-chloro-1,3-benzoxazol-2-yl)-N'-methylethane-1,2-diamine?
The canonical SMILES for N'-(5-chloro-1,3-benzoxazol-2-yl)-N'-methylethane-1,2-diamine is CN(CCN)c1nc2cc(Cl)ccc2o1.
What is the InChIKey of N'-(5-chloro-1,3-benzoxazol-2-yl)-N'-methylethane-1,2-diamine?
The InChIKey is FJDNYAHTMBAGRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClN3O/c1-14(5-4-12)10-13-8-6-7(11)2-3-9(8)15-10/h2-3,6H,4-5,12H2,1H3.
What are the key properties of N'-(5-chloro-1,3-benzoxazol-2-yl)-N'-methylethane-1,2-diamine?
N'-(5-chloro-1,3-benzoxazol-2-yl)-N'-methylethane-1,2-diamine has a molecular weight of 225.68 g/mol, XLogP of 1.88, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(5-chloro-1,3-benzoxazol-2-yl)-N'-methylethane-1,2-diamine is sourced from PubChem (CID 83839740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).