C8H5ClN2O2 — CID 15309009
3-amino-6-chloro-1,4-benzoxazin-2-one (PubChem CID 15309009) has the molecular formula C8H5ClN2O2 and a molecular weight of 196.59 g/mol. Its IUPAC name is 3-amino-6-chloro-1,4-benzoxazin-2-one.
| Compound Name | 3-amino-6-chloro-1,4-benzoxazin-2-one |
|---|---|
| PubChem CID | 15309009 |
| Molecular Formula | C8H5ClN2O2 |
| Molecular Weight | 196.59 g/mol |
| Exact Mass | 196.00 |
| IUPAC Name | 3-amino-6-chloro-1,4-benzoxazin-2-one |
| SMILES | Nc1nc2cc(Cl)ccc2oc1=O |
| InChI | InChI=1S/C8H5ClN2O2/c9-4-1-2-6-5(3-4)11-7(10)8(12)13-6/h1-3H,(H2,10,11) |
| InChIKey | GLBMVQYBFMVRLZ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.59 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'coumarin_C(1)', 'substructure': 'N/A'} |
|---|