C17H11ClN2O — CID 28896820
3-(5-chloro-1,3-benzoxazol-2-yl)naphthalen-2-amine (PubChem CID 28896820) has the molecular formula C17H11ClN2O and a molecular weight of 294.74 g/mol. Its IUPAC name is 3-(5-chloro-1,3-benzoxazol-2-yl)naphthalen-2-amine.
| Compound Name | 3-(5-chloro-1,3-benzoxazol-2-yl)naphthalen-2-amine |
|---|---|
| PubChem CID | 28896820 |
| Molecular Formula | C17H11ClN2O |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 3-(5-chloro-1,3-benzoxazol-2-yl)naphthalen-2-amine |
| SMILES | Nc1cc2ccccc2cc1-c1nc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C17H11ClN2O/c18-12-5-6-16-15(9-12)20-17(21-16)13-7-10-3-1-2-4-11(10)8-14(13)19/h1-9H,19H2 |
| InChIKey | GLDAJVTVAYGSKG-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|