C13H7Cl2FN2O — CID 82720968
5-chloro-2-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)aniline (PubChem CID 82720968) has the molecular formula C13H7Cl2FN2O and a molecular weight of 297.12 g/mol. Its IUPAC name is 5-chloro-2-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)aniline.
| Compound Name | 5-chloro-2-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)aniline |
|---|---|
| PubChem CID | 82720968 |
| Molecular Formula | C13H7Cl2FN2O |
| Molecular Weight | 297.12 g/mol |
| Exact Mass | 295.99 |
| IUPAC Name | 5-chloro-2-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)aniline |
| SMILES | Nc1cc(Cl)ccc1-c1nc2cc(Cl)c(F)cc2o1 |
| InChI | InChI=1S/C13H7Cl2FN2O/c14-6-1-2-7(10(17)3-6)13-18-11-4-8(15)9(16)5-12(11)19-13/h1-5H,17H2 |
| InChIKey | HFCLHEWUVAURAC-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.12 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|