C14H12FN3O — CID 163612509
2-(4-amino-2-methylphenyl)-6-fluoro-1,3-benzoxazol-5-amine (PubChem CID 163612509) has the molecular formula C14H12FN3O and a molecular weight of 257.27 g/mol. Its IUPAC name is 2-(4-amino-2-methylphenyl)-6-fluoro-1,3-benzoxazol-5-amine.
| Compound Name | 2-(4-amino-2-methylphenyl)-6-fluoro-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 163612509 |
| Molecular Formula | C14H12FN3O |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 2-(4-amino-2-methylphenyl)-6-fluoro-1,3-benzoxazol-5-amine |
| SMILES | Cc1cc(N)ccc1-c1nc2cc(N)c(F)cc2o1 |
| InChI | InChI=1S/C14H12FN3O/c1-7-4-8(16)2-3-9(7)14-18-12-6-11(17)10(15)5-13(12)19-14/h2-6H,16-17H2,1H3 |
| InChIKey | YNOWMKSGNZUMSJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|