C13H7ClF2N2O — CID 82771441
2-(4-chloro-2,5-difluorophenyl)-1,3-benzoxazol-6-amine (PubChem CID 82771441) has the molecular formula C13H7ClF2N2O and a molecular weight of 280.66 g/mol. Its IUPAC name is 2-(4-chloro-2,5-difluorophenyl)-1,3-benzoxazol-6-amine.
| Compound Name | 2-(4-chloro-2,5-difluorophenyl)-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 82771441 |
| Molecular Formula | C13H7ClF2N2O |
| Molecular Weight | 280.66 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | 2-(4-chloro-2,5-difluorophenyl)-1,3-benzoxazol-6-amine |
| SMILES | Nc1ccc2nc(-c3cc(F)c(Cl)cc3F)oc2c1 |
| InChI | InChI=1S/C13H7ClF2N2O/c14-8-5-9(15)7(4-10(8)16)13-18-11-2-1-6(17)3-12(11)19-13/h1-5H,17H2 |
| InChIKey | WCSVFGYDEHMRCQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.66 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|