C15H12F3N3O — CID 163612515
2-(4-amino-2-methylphenyl)-7-(trifluoromethyl)-1,3-benzoxazol-5-amine (PubChem CID 163612515) has the molecular formula C15H12F3N3O and a molecular weight of 307.28 g/mol. Its IUPAC name is 2-(4-amino-2-methylphenyl)-7-(trifluoromethyl)-1,3-benzoxazol-5-amine.
| Compound Name | 2-(4-amino-2-methylphenyl)-7-(trifluoromethyl)-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 163612515 |
| Molecular Formula | C15H12F3N3O |
| Molecular Weight | 307.28 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 2-(4-amino-2-methylphenyl)-7-(trifluoromethyl)-1,3-benzoxazol-5-amine |
| SMILES | Cc1cc(N)ccc1-c1nc2cc(N)cc(C(F)(F)F)c2o1 |
| InChI | InChI=1S/C15H12F3N3O/c1-7-4-8(19)2-3-10(7)14-21-12-6-9(20)5-11(13(12)22-14)15(16,17)18/h2-6H,19-20H2,1H3 |
| InChIKey | VMQCHVZZHJUVND-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.28 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|