C8H9N3O — CID 95910767
7-methyl-1,3-benzoxazole-2,5-diamine (PubChem CID 95910767) has the molecular formula C8H9N3O and a molecular weight of 163.18 g/mol. Its IUPAC name is 7-methyl-1,3-benzoxazole-2,5-diamine.
| Compound Name | 7-methyl-1,3-benzoxazole-2,5-diamine |
|---|---|
| PubChem CID | 95910767 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 7-methyl-1,3-benzoxazole-2,5-diamine |
| SMILES | Cc1cc(N)cc2nc(N)oc12 |
| InChI | InChI=1S/C8H9N3O/c1-4-2-5(9)3-6-7(4)12-8(10)11-6/h2-3H,9H2,1H3,(H2,10,11) |
| InChIKey | LNYUPTPDKAWJSL-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|