C8H6F2N2O — CID 130512810
4,5-difluoro-7-methyl-1,3-benzoxazol-2-amine (PubChem CID 130512810) has the molecular formula C8H6F2N2O and a molecular weight of 184.15 g/mol. Its IUPAC name is 4,5-difluoro-7-methyl-1,3-benzoxazol-2-amine.
| Compound Name | 4,5-difluoro-7-methyl-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 130512810 |
| Molecular Formula | C8H6F2N2O |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | 4,5-difluoro-7-methyl-1,3-benzoxazol-2-amine |
| SMILES | Cc1cc(F)c(F)c2nc(N)oc12 |
| InChI | InChI=1S/C8H6F2N2O/c1-3-2-4(9)5(10)6-7(3)13-8(11)12-6/h2H,1H3,(H2,11,12) |
| InChIKey | CYCMFIIJOXWEBD-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |