C10H7F3N2 — CID 63232439
5,6,7-trifluoro-3-methylquinolin-2-amine (PubChem CID 63232439) has the molecular formula C10H7F3N2 and a molecular weight of 212.17 g/mol. Its IUPAC name is 5,6,7-trifluoro-3-methylquinolin-2-amine.
| Compound Name | 5,6,7-trifluoro-3-methylquinolin-2-amine |
|---|---|
| PubChem CID | 63232439 |
| Molecular Formula | C10H7F3N2 |
| Molecular Weight | 212.17 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 5,6,7-trifluoro-3-methylquinolin-2-amine |
| SMILES | Cc1cc2c(F)c(F)c(F)cc2nc1N |
| InChI | InChI=1S/C10H7F3N2/c1-4-2-5-7(15-10(4)14)3-6(11)9(13)8(5)12/h2-3H,1H3,(H2,14,15) |
| InChIKey | UCNPVQCCSZTCNR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.17 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|