C11H11FN2 — CID 63231677
5-fluoro-3,8-dimethylquinolin-2-amine (PubChem CID 63231677) has the molecular formula C11H11FN2 and a molecular weight of 190.22 g/mol. Its IUPAC name is 5-fluoro-3,8-dimethylquinolin-2-amine.
| Compound Name | 5-fluoro-3,8-dimethylquinolin-2-amine |
|---|---|
| PubChem CID | 63231677 |
| Molecular Formula | C11H11FN2 |
| Molecular Weight | 190.22 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 5-fluoro-3,8-dimethylquinolin-2-amine |
| SMILES | Cc1cc2c(F)ccc(C)c2nc1N |
| InChI | InChI=1S/C11H11FN2/c1-6-3-4-9(12)8-5-7(2)11(13)14-10(6)8/h3-5H,1-2H3,(H2,13,14) |
| InChIKey | WWIJAACLPOCYEG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.22 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |