C12H15ClN2 — CID 43866004
3,7,8-trimethylquinolin-2-amine;hydrochloride (PubChem CID 43866004) has the molecular formula C12H15ClN2 and a molecular weight of 222.72 g/mol. Its IUPAC name is 3,7,8-trimethylquinolin-2-amine;hydrochloride.
| Compound Name | 3,7,8-trimethylquinolin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 43866004 |
| Molecular Formula | C12H15ClN2 |
| Molecular Weight | 222.72 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 3,7,8-trimethylquinolin-2-amine;hydrochloride |
| SMILES | Cc1cc2ccc(C)c(C)c2nc1N.Cl |
| InChI | InChI=1S/C12H14N2.ClH/c1-7-4-5-10-6-8(2)12(13)14-11(10)9(7)3;/h4-6H,1-3H3,(H2,13,14);1H |
| InChIKey | ZWYLZQKQLONAII-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.72 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |