C10H11N3 — CID 143854543
8-methylquinoline-2,6-diamine (PubChem CID 143854543) has the molecular formula C10H11N3 and a molecular weight of 173.22 g/mol. Its IUPAC name is 8-methylquinoline-2,6-diamine.
| Compound Name | 8-methylquinoline-2,6-diamine |
|---|---|
| PubChem CID | 143854543 |
| Molecular Formula | C10H11N3 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | 8-methylquinoline-2,6-diamine |
| SMILES | Cc1cc(N)cc2ccc(N)nc12 |
| InChI | InChI=1S/C10H11N3/c1-6-4-8(11)5-7-2-3-9(12)13-10(6)7/h2-5H,11H2,1H3,(H2,12,13) |
| InChIKey | BADTXSOPCOJQLV-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|