C15H24N2O — CID 145281381
2-amino-5,7-dimethylquinolin-8-ol;ethane (PubChem CID 145281381) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is 2-amino-5,7-dimethylquinolin-8-ol;ethane.
| Compound Name | 2-amino-5,7-dimethylquinolin-8-ol;ethane |
|---|---|
| PubChem CID | 145281381 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 2-amino-5,7-dimethylquinolin-8-ol;ethane |
| SMILES | CC.CC.Cc1cc(C)c2ccc(N)nc2c1O |
| InChI | InChI=1S/C11H12N2O.2C2H6/c1-6-5-7(2)11(14)10-8(6)3-4-9(12)13-10;2*1-2/h3-5,14H,1-2H3,(H2,12,13);2*1-2H3 |
| InChIKey | QDXYTNWCCLDGAY-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |