C12H14N2O — CID 137126071
2,3,6,8-tetramethylquinoxalin-5-ol (PubChem CID 137126071) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 2,3,6,8-tetramethylquinoxalin-5-ol.
| Compound Name | 2,3,6,8-tetramethylquinoxalin-5-ol |
|---|---|
| PubChem CID | 137126071 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 2,3,6,8-tetramethylquinoxalin-5-ol |
| SMILES | Cc1cc(C)c2nc(C)c(C)nc2c1O |
| InChI | InChI=1S/C12H14N2O/c1-6-5-7(2)12(15)11-10(6)13-8(3)9(4)14-11/h5,15H,1-4H3 |
| InChIKey | MJEJPWLTJOIDHE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |