C15H13BrN2O — CID 157112481
4-bromo-2,6,8-trimethylphenazin-1-ol (PubChem CID 157112481) has the molecular formula C15H13BrN2O and a molecular weight of 317.19 g/mol. Its IUPAC name is 4-bromo-2,6,8-trimethylphenazin-1-ol.
| Compound Name | 4-bromo-2,6,8-trimethylphenazin-1-ol |
|---|---|
| PubChem CID | 157112481 |
| Molecular Formula | C15H13BrN2O |
| Molecular Weight | 317.19 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 4-bromo-2,6,8-trimethylphenazin-1-ol |
| SMILES | Cc1cc(C)c2nc3c(Br)cc(C)c(O)c3nc2c1 |
| InChI | InChI=1S/C15H13BrN2O/c1-7-4-8(2)12-11(5-7)17-14-13(18-12)10(16)6-9(3)15(14)19/h4-6,19H,1-3H3 |
| InChIKey | RAZBXSHQYOWSJC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.19 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|