C12H11BrO — CID 121007840
2-bromo-6,8-dimethylnaphthalen-1-ol (PubChem CID 121007840) has the molecular formula C12H11BrO and a molecular weight of 251.12 g/mol. Its IUPAC name is 2-bromo-6,8-dimethylnaphthalen-1-ol.
| Compound Name | 2-bromo-6,8-dimethylnaphthalen-1-ol |
|---|---|
| PubChem CID | 121007840 |
| Molecular Formula | C12H11BrO |
| Molecular Weight | 251.12 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | 2-bromo-6,8-dimethylnaphthalen-1-ol |
| SMILES | Cc1cc(C)c2c(O)c(Br)ccc2c1 |
| InChI | InChI=1S/C12H11BrO/c1-7-5-8(2)11-9(6-7)3-4-10(13)12(11)14/h3-6,14H,1-2H3 |
| InChIKey | FUMHQBCDFYDRBD-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.12 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |