C17H15F — CID 59121353
5-fluoro-1,3,7-trimethylphenanthrene (PubChem CID 59121353) has the molecular formula C17H15F and a molecular weight of 238.30 g/mol. Its IUPAC name is 5-fluoro-1,3,7-trimethylphenanthrene.
| Compound Name | 5-fluoro-1,3,7-trimethylphenanthrene |
|---|---|
| PubChem CID | 59121353 |
| Molecular Formula | C17H15F |
| Molecular Weight | 238.30 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 5-fluoro-1,3,7-trimethylphenanthrene |
| SMILES | Cc1cc(F)c2c(ccc3c(C)cc(C)cc32)c1 |
| InChI | InChI=1S/C17H15F/c1-10-6-12(3)14-5-4-13-7-11(2)9-16(18)17(13)15(14)8-10/h4-9H,1-3H3 |
| InChIKey | GGGQLNFLOLQGGL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.30 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|