C36H30F6 — CID 159577339
1,3-difluoro-2,6-dimethylnaphthalene;1-fluoro-2,6-dimethylnaphthalene;1,3,8-trifluoro-2,6-dimethylnaphthalene (PubChem CID 159577339) has the molecular formula C36H30F6 and a molecular weight of 576.62 g/mol. Its IUPAC name is 1,3-difluoro-2,6-dimethylnaphthalene;1-fluoro-2,6-dimethylnaphthalene;1,3,8-trifluoro-2,6-dimethylnaphthalene.
| Compound Name | 1,3-difluoro-2,6-dimethylnaphthalene;1-fluoro-2,6-dimethylnaphthalene;1,3,8-trifluoro-2,6-dimethylnaphthalene |
|---|---|
| PubChem CID | 159577339 |
| Molecular Formula | C36H30F6 |
| Molecular Weight | 576.62 g/mol |
| Exact Mass | 576.23 |
| IUPAC Name | 1,3-difluoro-2,6-dimethylnaphthalene;1-fluoro-2,6-dimethylnaphthalene;1,3,8-trifluoro-2,6-dimethylnaphthalene |
| SMILES | Cc1cc(F)c2c(F)c(C)c(F)cc2c1.Cc1ccc2c(F)c(C)c(F)cc2c1.Cc1ccc2c(F)c(C)ccc2c1 |
| InChI | InChI=1S/C12H9F3.C12H10F2.C12H11F/c1-6-3-8-5-9(13)7(2)12(15)11(8)10(14)4-6;1-7-3-4-10-9(5-7)6-11(13)8(2)12(10)14;1-8-3-6-11-10(7-8)5-4-9(2)12(11)13/h3-5H,1-2H3;3-6H,1-2H3;3-7H,1-2H3 |
| InChIKey | MIOOTMKUDVSUIK-UHFFFAOYSA-N |
| XLogP | 11.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.62 |
| LogP ≤ 5 | 11.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |