C48H40F8 — CID 162198404
1,3-difluoro-2,6-dimethylnaphthalene;bis(1,4-difluoro-2,6-dimethylnaphthalene);1,7-difluoro-2,6-dimethylnaphthalene (PubChem CID 162198404) has the molecular formula C48H40F8 and a molecular weight of 768.83 g/mol. Its IUPAC name is 1,3-difluoro-2,6-dimethylnaphthalene;bis(1,4-difluoro-2,6-dimethylnaphthalene);1,7-difluoro-2,6-dimethylnaphthalene.
| Compound Name | 1,3-difluoro-2,6-dimethylnaphthalene;bis(1,4-difluoro-2,6-dimethylnaphthalene);1,7-difluoro-2,6-dimethylnaphthalene |
|---|---|
| PubChem CID | 162198404 |
| Molecular Formula | C48H40F8 |
| Molecular Weight | 768.83 g/mol |
| Exact Mass | 768.30 |
| IUPAC Name | 1,3-difluoro-2,6-dimethylnaphthalene;bis(1,4-difluoro-2,6-dimethylnaphthalene);1,7-difluoro-2,6-dimethylnaphthalene |
| SMILES | Cc1cc2ccc(C)c(F)c2cc1F.Cc1ccc2c(F)c(C)c(F)cc2c1.Cc1ccc2c(F)c(C)cc(F)c2c1.Cc1ccc2c(F)c(C)cc(F)c2c1 |
| InChI | InChI=1S/4C12H10F2/c1-7-3-4-9-5-8(2)11(13)6-10(9)12(7)14;1-7-3-4-10-9(5-7)6-11(13)8(2)12(10)14;2*1-7-3-4-9-10(5-7)11(13)6-8(2)12(9)14/h4*3-6H,1-2H3 |
| InChIKey | ZRGHIVHGWMTZAO-UHFFFAOYSA-N |
| XLogP | 14.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.83 |
| LogP ≤ 5 | 14.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |