C24H24F6 — CID 160856568
1,3-difluoro-2,5-dimethylbenzene;2-fluoro-1,4-dimethylbenzene;1,3,4-trifluoro-2,5-dimethylbenzene (PubChem CID 160856568) has the molecular formula C24H24F6 and a molecular weight of 426.44 g/mol. Its IUPAC name is 1,3-difluoro-2,5-dimethylbenzene;2-fluoro-1,4-dimethylbenzene;1,3,4-trifluoro-2,5-dimethylbenzene.
| Compound Name | 1,3-difluoro-2,5-dimethylbenzene;2-fluoro-1,4-dimethylbenzene;1,3,4-trifluoro-2,5-dimethylbenzene |
|---|---|
| PubChem CID | 160856568 |
| Molecular Formula | C24H24F6 |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 1,3-difluoro-2,5-dimethylbenzene;2-fluoro-1,4-dimethylbenzene;1,3,4-trifluoro-2,5-dimethylbenzene |
| SMILES | Cc1cc(F)c(C)c(F)c1.Cc1cc(F)c(C)c(F)c1F.Cc1ccc(C)c(F)c1 |
| InChI | InChI=1S/C8H7F3.C8H8F2.C8H9F/c1-4-3-6(9)5(2)8(11)7(4)10;1-5-3-7(9)6(2)8(10)4-5;1-6-3-4-7(2)8(9)5-6/h3H,1-2H3;3-4H,1-2H3;3-5H,1-2H3 |
| InChIKey | SJXYZVHCBNUKBX-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|