C12H10ClF — CID 146207185
3-chloro-1-fluoro-2,7-dimethylnaphthalene (PubChem CID 146207185) has the molecular formula C12H10ClF and a molecular weight of 208.66 g/mol. Its IUPAC name is 3-chloro-1-fluoro-2,7-dimethylnaphthalene.
| Compound Name | 3-chloro-1-fluoro-2,7-dimethylnaphthalene |
|---|---|
| PubChem CID | 146207185 |
| Molecular Formula | C12H10ClF |
| Molecular Weight | 208.66 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 3-chloro-1-fluoro-2,7-dimethylnaphthalene |
| SMILES | Cc1ccc2cc(Cl)c(C)c(F)c2c1 |
| InChI | InChI=1S/C12H10ClF/c1-7-3-4-9-6-11(13)8(2)12(14)10(9)5-7/h3-6H,1-2H3 |
| InChIKey | HPAHNSQZUDGTQV-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.66 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |