C16H13F — CID 21032854
1-fluoro-2,7-dimethylphenanthrene (PubChem CID 21032854) has the molecular formula C16H13F and a molecular weight of 224.28 g/mol. Its IUPAC name is 1-fluoro-2,7-dimethylphenanthrene.
| Compound Name | 1-fluoro-2,7-dimethylphenanthrene |
|---|---|
| PubChem CID | 21032854 |
| Molecular Formula | C16H13F |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 1-fluoro-2,7-dimethylphenanthrene |
| SMILES | Cc1ccc2c(ccc3c(F)c(C)ccc32)c1 |
| InChI | InChI=1S/C16H13F/c1-10-3-6-13-12(9-10)5-8-15-14(13)7-4-11(2)16(15)17/h3-9H,1-2H3 |
| InChIKey | FSXKQVRSCWZJBP-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|