C14H12 — CID 142157789
1-ethynyl-2,6-dimethylnaphthalene (PubChem CID 142157789) has the molecular formula C14H12 and a molecular weight of 180.25 g/mol. Its IUPAC name is 1-ethynyl-2,6-dimethylnaphthalene.
| Compound Name | 1-ethynyl-2,6-dimethylnaphthalene |
|---|---|
| PubChem CID | 142157789 |
| Molecular Formula | C14H12 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 1-ethynyl-2,6-dimethylnaphthalene |
| SMILES | C#Cc1c(C)ccc2cc(C)ccc12 |
| InChI | InChI=1S/C14H12/c1-4-13-11(3)6-7-12-9-10(2)5-8-14(12)13/h1,5-9H,2-3H3 |
| InChIKey | XNLXVNNJYGYOMU-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|