C16H13I — CID 137452245
1-iodo-2,6-dimethylanthracene (PubChem CID 137452245) has the molecular formula C16H13I and a molecular weight of 332.18 g/mol. Its IUPAC name is 1-iodo-2,6-dimethylanthracene.
| Compound Name | 1-iodo-2,6-dimethylanthracene |
|---|---|
| PubChem CID | 137452245 |
| Molecular Formula | C16H13I |
| Molecular Weight | 332.18 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 1-iodo-2,6-dimethylanthracene |
| SMILES | Cc1ccc2cc3c(I)c(C)ccc3cc2c1 |
| InChI | InChI=1S/C16H13I/c1-10-3-5-12-9-15-13(8-14(12)7-10)6-4-11(2)16(15)17/h3-9H,1-2H3 |
| InChIKey | DPRNESAJPIYYRB-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.18 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|