C19H18 — CID 177251791
9-methyl-1,2,3,4-tetrahydrobenzo[a]anthracene (PubChem CID 177251791) has the molecular formula C19H18 and a molecular weight of 246.35 g/mol. Its IUPAC name is 9-methyl-1,2,3,4-tetrahydrobenzo[a]anthracene.
| Compound Name | 9-methyl-1,2,3,4-tetrahydrobenzo[a]anthracene |
|---|---|
| PubChem CID | 177251791 |
| Molecular Formula | C19H18 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 9-methyl-1,2,3,4-tetrahydrobenzo[a]anthracene |
| SMILES | Cc1ccc2cc3c4c(ccc3cc2c1)CCCC4 |
| InChI | InChI=1S/C19H18/c1-13-6-7-15-12-19-16(11-17(15)10-13)9-8-14-4-2-3-5-18(14)19/h6-12H,2-5H2,1H3 |
| InChIKey | YHJFLWUCCSCJGO-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|