C18H17N — CID 174397355
7,8,9,10-tetrahydrochrysen-2-amine (PubChem CID 174397355) has the molecular formula C18H17N and a molecular weight of 247.34 g/mol. Its IUPAC name is 7,8,9,10-tetrahydrochrysen-2-amine.
| Compound Name | 7,8,9,10-tetrahydrochrysen-2-amine |
|---|---|
| PubChem CID | 174397355 |
| Molecular Formula | C18H17N |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 7,8,9,10-tetrahydrochrysen-2-amine |
| SMILES | Nc1ccc2c(ccc3c4c(ccc32)CCCC4)c1 |
| InChI | InChI=1S/C18H17N/c19-14-7-10-16-13(11-14)6-9-17-15-4-2-1-3-12(15)5-8-18(16)17/h5-11H,1-4,19H2 |
| InChIKey | NFEBQDHWYOOGMW-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|