C30H29N3 — CID 174472851
4-(4-aminophenyl)benzene-1,3-diamine;1,2,3,4-tetrahydrochrysene (PubChem CID 174472851) has the molecular formula C30H29N3 and a molecular weight of 431.58 g/mol. Its IUPAC name is 4-(4-aminophenyl)benzene-1,3-diamine;1,2,3,4-tetrahydrochrysene.
| Compound Name | 4-(4-aminophenyl)benzene-1,3-diamine;1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 174472851 |
| Molecular Formula | C30H29N3 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | 4-(4-aminophenyl)benzene-1,3-diamine;1,2,3,4-tetrahydrochrysene |
| SMILES | Nc1ccc(-c2ccc(N)cc2N)cc1.c1ccc2c(c1)ccc1c3c(ccc12)CCCC3 |
| InChI | InChI=1S/C18H16.C12H13N3/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;13-9-3-1-8(2-4-9)11-6-5-10(14)7-12(11)15/h1,3,5,7,9-12H,2,4,6,8H2;1-7H,13-15H2 |
| InChIKey | BLAMKQJTUKOPJR-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|