C31H26N2 — CID 175372875
acridine;7,8,9,10-tetrahydrochrysen-3-amine (PubChem CID 175372875) has the molecular formula C31H26N2 and a molecular weight of 426.56 g/mol. Its IUPAC name is acridine;7,8,9,10-tetrahydrochrysen-3-amine.
| Compound Name | acridine;7,8,9,10-tetrahydrochrysen-3-amine |
|---|---|
| PubChem CID | 175372875 |
| Molecular Formula | C31H26N2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | acridine;7,8,9,10-tetrahydrochrysen-3-amine |
| SMILES | Nc1ccc2ccc3c4c(ccc3c2c1)CCCC4.c1ccc2nc3ccccc3cc2c1 |
| InChI | InChI=1S/C18H17N.C13H9N/c19-14-8-5-13-7-9-16-15-4-2-1-3-12(15)6-10-17(16)18(13)11-14;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h5-11H,1-4,19H2;1-9H |
| InChIKey | ZHHUXVHLNVTMQA-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|