About acridine;7,8,9,10-tetrahydrochrysen-3-amine
acridine;7,8,9,10-tetrahydrochrysen-3-amine (PubChem CID 175372875) has the molecular formula C31H26N2
and a molecular weight of 426.56 g/mol. Its IUPAC name is acridine;7,8,9,10-tetrahydrochrysen-3-amine.
Molecular Properties
| Compound Name | acridine;7,8,9,10-tetrahydrochrysen-3-amine |
| PubChem CID | 175372875 |
| Molecular Formula | C31H26N2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | acridine;7,8,9,10-tetrahydrochrysen-3-amine |
| SMILES | Nc1ccc2ccc3c4c(ccc3c2c1)CCCC4.c1ccc2nc3ccccc3cc2c1 |
| InChI | InChI=1S/C18H17N.C13H9N/c19-14-8-5-13-7-9-16-15-4-2-1-3-12(15)6-10-17(16)18(13)11-14;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h5-11H,1-4,19H2;1-9H |
| InChIKey | ZHHUXVHLNVTMQA-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze acridine;7,8,9,10-tetrahydrochrysen-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acridine;7,8,9,10-tetrahydrochrysen-3-amine?
The IUPAC name of acridine;7,8,9,10-tetrahydrochrysen-3-amine (CID 175372875) is acridine;7,8,9,10-tetrahydrochrysen-3-amine.
What is the SMILES notation for acridine;7,8,9,10-tetrahydrochrysen-3-amine?
The canonical SMILES for acridine;7,8,9,10-tetrahydrochrysen-3-amine is Nc1ccc2ccc3c4c(ccc3c2c1)CCCC4.c1ccc2nc3ccccc3cc2c1.
What is the InChIKey of acridine;7,8,9,10-tetrahydrochrysen-3-amine?
The InChIKey is ZHHUXVHLNVTMQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N.C13H9N/c19-14-8-5-13-7-9-16-15-4-2-1-3-12(15)6-10-17(16)18(13)11-14;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h5-11H,1-4,19H2;1-9H.
What are the key properties of acridine;7,8,9,10-tetrahydrochrysen-3-amine?
acridine;7,8,9,10-tetrahydrochrysen-3-amine has a molecular weight of 426.56 g/mol, XLogP of 7.84, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acridine;7,8,9,10-tetrahydrochrysen-3-amine is sourced from PubChem (CID 175372875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).