C27H23N — CID 174331390
quinoline;1,2,3,4-tetrahydrochrysene (PubChem CID 174331390) has the molecular formula C27H23N and a molecular weight of 361.49 g/mol. Its IUPAC name is quinoline;1,2,3,4-tetrahydrochrysene.
| Compound Name | quinoline;1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 174331390 |
| Molecular Formula | C27H23N |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | quinoline;1,2,3,4-tetrahydrochrysene |
| SMILES | c1ccc2c(c1)ccc1c3c(ccc12)CCCC3.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C18H16.C9H7N/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-2-6-9-8(4-1)5-3-7-10-9/h1,3,5,7,9-12H,2,4,6,8H2;1-7H |
| InChIKey | GLRYHJHAVFOSGG-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|