C28H25NO — CID 174377891
7-methoxyquinoline;1,2,3,4-tetrahydrochrysene (PubChem CID 174377891) has the molecular formula C28H25NO and a molecular weight of 391.51 g/mol. Its IUPAC name is 7-methoxyquinoline;1,2,3,4-tetrahydrochrysene.
| Compound Name | 7-methoxyquinoline;1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 174377891 |
| Molecular Formula | C28H25NO |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 7-methoxyquinoline;1,2,3,4-tetrahydrochrysene |
| SMILES | COc1ccc2cccnc2c1.c1ccc2c(c1)ccc1c3c(ccc12)CCCC3 |
| InChI | InChI=1S/C18H16.C10H9NO/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-12-9-5-4-8-3-2-6-11-10(8)7-9/h1,3,5,7,9-12H,2,4,6,8H2;2-7H,1H3 |
| InChIKey | ZRYXCOKVDKGUBF-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|