C30H29N3O — CID 174896543
4,5-dihydro-1,3-oxazol-2-amine;quinoline;1,2,3,4-tetrahydrochrysene (PubChem CID 174896543) has the molecular formula C30H29N3O and a molecular weight of 447.58 g/mol. Its IUPAC name is 4,5-dihydro-1,3-oxazol-2-amine;quinoline;1,2,3,4-tetrahydrochrysene.
| Compound Name | 4,5-dihydro-1,3-oxazol-2-amine;quinoline;1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 174896543 |
| Molecular Formula | C30H29N3O |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 4,5-dihydro-1,3-oxazol-2-amine;quinoline;1,2,3,4-tetrahydrochrysene |
| SMILES | NC1=NCCO1.c1ccc2c(c1)ccc1c3c(ccc12)CCCC3.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C18H16.C9H7N.C3H6N2O/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-2-6-9-8(4-1)5-3-7-10-9;4-3-5-1-2-6-3/h1,3,5,7,9-12H,2,4,6,8H2;1-7H;1-2H2,(H2,4,5) |
| InChIKey | MJXRSNMTTVDKIK-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|