C25H21NS — CID 174462894
1,3-benzothiazole;1,2,3,4-tetrahydrochrysene (PubChem CID 174462894) has the molecular formula C25H21NS and a molecular weight of 367.52 g/mol. Its IUPAC name is 1,3-benzothiazole;1,2,3,4-tetrahydrochrysene.
| Compound Name | 1,3-benzothiazole;1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 174462894 |
| Molecular Formula | C25H21NS |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 1,3-benzothiazole;1,2,3,4-tetrahydrochrysene |
| SMILES | c1ccc2c(c1)ccc1c3c(ccc12)CCCC3.c1ccc2scnc2c1 |
| InChI | InChI=1S/C18H16.C7H5NS/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-2-4-7-6(3-1)8-5-9-7/h1,3,5,7,9-12H,2,4,6,8H2;1-5H |
| InChIKey | FRAWETFZFGETKO-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|