C22H22BrNS — CID 174283685
1,2,3,4-tetrahydrochrysene;2H-1,3-thiazine;hydrobromide (PubChem CID 174283685) has the molecular formula C22H22BrNS and a molecular weight of 412.40 g/mol. Its IUPAC name is 1,2,3,4-tetrahydrochrysene;2H-1,3-thiazine;hydrobromide.
| Compound Name | 1,2,3,4-tetrahydrochrysene;2H-1,3-thiazine;hydrobromide |
|---|---|
| PubChem CID | 174283685 |
| Molecular Formula | C22H22BrNS |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | 1,2,3,4-tetrahydrochrysene;2H-1,3-thiazine;hydrobromide |
| SMILES | Br.C1=CSCN=C1.c1ccc2c(c1)ccc1c3c(ccc12)CCCC3 |
| InChI | InChI=1S/C18H16.C4H5NS.BrH/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-2-5-4-6-3-1;/h1,3,5,7,9-12H,2,4,6,8H2;1-3H,4H2;1H |
| InChIKey | JIPYIGUHMYALJG-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|