C26H22N2 — CID 174401124
1,6-naphthyridine;1,2,3,4-tetrahydrochrysene (PubChem CID 174401124) has the molecular formula C26H22N2 and a molecular weight of 362.48 g/mol. Its IUPAC name is 1,6-naphthyridine;1,2,3,4-tetrahydrochrysene.
| Compound Name | 1,6-naphthyridine;1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 174401124 |
| Molecular Formula | C26H22N2 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 1,6-naphthyridine;1,2,3,4-tetrahydrochrysene |
| SMILES | c1ccc2c(c1)ccc1c3c(ccc12)CCCC3.c1cnc2ccncc2c1 |
| InChI | InChI=1S/C18H16.C8H6N2/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-2-7-6-9-5-3-8(7)10-4-1/h1,3,5,7,9-12H,2,4,6,8H2;1-6H |
| InChIKey | UCFTXYTWMJCEFI-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|