C27H22ClN — CID 174474969
7-chloro-1,2,3,4-tetrahydrochrysene;isoquinoline (PubChem CID 174474969) has the molecular formula C27H22ClN and a molecular weight of 395.93 g/mol. Its IUPAC name is 7-chloro-1,2,3,4-tetrahydrochrysene;isoquinoline.
| Compound Name | 7-chloro-1,2,3,4-tetrahydrochrysene;isoquinoline |
|---|---|
| PubChem CID | 174474969 |
| Molecular Formula | C27H22ClN |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 7-chloro-1,2,3,4-tetrahydrochrysene;isoquinoline |
| SMILES | Clc1cccc2c1ccc1c3c(ccc12)CCCC3.c1ccc2cnccc2c1 |
| InChI | InChI=1S/C18H15Cl.C9H7N/c19-18-7-3-6-14-16-9-8-12-4-1-2-5-13(12)15(16)10-11-17(14)18;1-2-4-9-7-10-6-5-8(9)3-1/h3,6-11H,1-2,4-5H2;1-7H |
| InChIKey | HEKGDLYFGHMXKY-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|