C27H23Cl2N — CID 174631486
8-chloro-1,2,3,4-tetrahydrochrysene;isoquinoline;hydrochloride (PubChem CID 174631486) has the molecular formula C27H23Cl2N and a molecular weight of 432.39 g/mol. Its IUPAC name is 8-chloro-1,2,3,4-tetrahydrochrysene;isoquinoline;hydrochloride.
| Compound Name | 8-chloro-1,2,3,4-tetrahydrochrysene;isoquinoline;hydrochloride |
|---|---|
| PubChem CID | 174631486 |
| Molecular Formula | C27H23Cl2N |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 8-chloro-1,2,3,4-tetrahydrochrysene;isoquinoline;hydrochloride |
| SMILES | Cl.Clc1ccc2c(ccc3c4c(ccc32)CCCC4)c1.c1ccc2cnccc2c1 |
| InChI | InChI=1S/C18H15Cl.C9H7N.ClH/c19-14-7-10-16-13(11-14)6-9-17-15-4-2-1-3-12(15)5-8-18(16)17;1-2-4-9-7-10-6-5-8(9)3-1;/h5-11H,1-4H2;1-7H;1H |
| InChIKey | SQEWWIAWPBKJPA-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|