C28H22F3NO — CID 174697385
1,2,3,4-tetrahydrochrysene;7-(trifluoromethoxy)isoquinoline (PubChem CID 174697385) has the molecular formula C28H22F3NO and a molecular weight of 445.48 g/mol. Its IUPAC name is 1,2,3,4-tetrahydrochrysene;7-(trifluoromethoxy)isoquinoline.
| Compound Name | 1,2,3,4-tetrahydrochrysene;7-(trifluoromethoxy)isoquinoline |
|---|---|
| PubChem CID | 174697385 |
| Molecular Formula | C28H22F3NO |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 1,2,3,4-tetrahydrochrysene;7-(trifluoromethoxy)isoquinoline |
| SMILES | FC(F)(F)Oc1ccc2ccncc2c1.c1ccc2c(c1)ccc1c3c(ccc12)CCCC3 |
| InChI | InChI=1S/C18H16.C10H6F3NO/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;11-10(12,13)15-9-2-1-7-3-4-14-6-8(7)5-9/h1,3,5,7,9-12H,2,4,6,8H2;1-6H |
| InChIKey | DDDBUSQMJKZUKJ-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|