C36H30N2O — CID 175313844
quinoline;1,2,3,4-tetrahydrochrysen-6-ol (PubChem CID 175313844) has the molecular formula C36H30N2O and a molecular weight of 506.65 g/mol. Its IUPAC name is quinoline;1,2,3,4-tetrahydrochrysen-6-ol.
| Compound Name | quinoline;1,2,3,4-tetrahydrochrysen-6-ol |
|---|---|
| PubChem CID | 175313844 |
| Molecular Formula | C36H30N2O |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | quinoline;1,2,3,4-tetrahydrochrysen-6-ol |
| SMILES | Oc1cc2c3c(ccc2c2ccccc12)CCCC3.c1ccc2ncccc2c1.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C18H16O.2C9H7N/c19-18-11-17-13-6-2-1-5-12(13)9-10-15(17)14-7-3-4-8-16(14)18;2*1-2-6-9-8(4-1)5-3-7-10-9/h3-4,7-11,19H,1-2,5-6H2;2*1-7H |
| InChIKey | UAIDYGSJUXISMK-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|