About 6-methoxy-1,2,3,4-tetrahydrophenanthrene
6-methoxy-1,2,3,4-tetrahydrophenanthrene (PubChem CID 14828207) has the molecular formula C15H16O
and a molecular weight of 212.29 g/mol. Its IUPAC name is 6-methoxy-1,2,3,4-tetrahydrophenanthrene.
Molecular Properties
| Compound Name | 6-methoxy-1,2,3,4-tetrahydrophenanthrene |
| PubChem CID | 14828207 |
| Molecular Formula | C15H16O |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 6-methoxy-1,2,3,4-tetrahydrophenanthrene |
| SMILES | COc1ccc2ccc3c(c2c1)CCCC3 |
| InChI | InChI=1S/C15H16O/c1-16-13-9-8-12-7-6-11-4-2-3-5-14(11)15(12)10-13/h6-10H,2-5H2,1H3 |
| InChIKey | GLEZDDHUQKEKBU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-methoxy-1,2,3,4-tetrahydrophenanthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-1,2,3,4-tetrahydrophenanthrene?
The IUPAC name of 6-methoxy-1,2,3,4-tetrahydrophenanthrene (CID 14828207) is 6-methoxy-1,2,3,4-tetrahydrophenanthrene.
What is the SMILES notation for 6-methoxy-1,2,3,4-tetrahydrophenanthrene?
The canonical SMILES for 6-methoxy-1,2,3,4-tetrahydrophenanthrene is COc1ccc2ccc3c(c2c1)CCCC3.
What is the InChIKey of 6-methoxy-1,2,3,4-tetrahydrophenanthrene?
The InChIKey is GLEZDDHUQKEKBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O/c1-16-13-9-8-12-7-6-11-4-2-3-5-14(11)15(12)10-13/h6-10H,2-5H2,1H3.
What are the key properties of 6-methoxy-1,2,3,4-tetrahydrophenanthrene?
6-methoxy-1,2,3,4-tetrahydrophenanthrene has a molecular weight of 212.29 g/mol, XLogP of 3.73, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-1,2,3,4-tetrahydrophenanthrene is sourced from PubChem (CID 14828207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).