C28H25N — CID 174893501
1-methyl-1,2,3,4-tetrahydrochrysene;quinoline (PubChem CID 174893501) has the molecular formula C28H25N and a molecular weight of 375.52 g/mol. Its IUPAC name is 1-methyl-1,2,3,4-tetrahydrochrysene;quinoline.
| Compound Name | 1-methyl-1,2,3,4-tetrahydrochrysene;quinoline |
|---|---|
| PubChem CID | 174893501 |
| Molecular Formula | C28H25N |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 1-methyl-1,2,3,4-tetrahydrochrysene;quinoline |
| SMILES | CC1CCCc2c1ccc1c2ccc2ccccc21.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C19H18.C9H7N/c1-13-5-4-8-17-15(13)11-12-18-16-7-3-2-6-14(16)9-10-19(17)18;1-2-6-9-8(4-1)5-3-7-10-9/h2-3,6-7,9-13H,4-5,8H2,1H3;1-7H |
| InChIKey | KUOBZISFWLJEDH-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|