C20H19N3 — CID 174338055
1,2,3,4-tetrahydrochrysene;1H-1,2,4-triazole (PubChem CID 174338055) has the molecular formula C20H19N3 and a molecular weight of 301.39 g/mol. Its IUPAC name is 1,2,3,4-tetrahydrochrysene;1H-1,2,4-triazole.
| Compound Name | 1,2,3,4-tetrahydrochrysene;1H-1,2,4-triazole |
|---|---|
| PubChem CID | 174338055 |
| Molecular Formula | C20H19N3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 1,2,3,4-tetrahydrochrysene;1H-1,2,4-triazole |
| SMILES | c1ccc2c(c1)ccc1c3c(ccc12)CCCC3.c1nc[nH]n1 |
| InChI | InChI=1S/C18H16.C2H3N3/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-3-2-5-4-1/h1,3,5,7,9-12H,2,4,6,8H2;1-2H,(H,3,4,5) |
| InChIKey | AJZFQTKBVZRCTR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|