About 3-methyl-7,8,9,10-tetrahydrobenzo[h]isoquinoline
3-methyl-7,8,9,10-tetrahydrobenzo[h]isoquinoline (PubChem CID 156549162) has the molecular formula C14H15N
and a molecular weight of 197.28 g/mol. Its IUPAC name is 3-methyl-7,8,9,10-tetrahydrobenzo[h]isoquinoline.
Molecular Properties
| Compound Name | 3-methyl-7,8,9,10-tetrahydrobenzo[h]isoquinoline |
| PubChem CID | 156549162 |
| Molecular Formula | C14H15N |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 3-methyl-7,8,9,10-tetrahydrobenzo[h]isoquinoline |
| SMILES | Cc1cc2ccc3c(c2cn1)CCCC3 |
| InChI | InChI=1S/C14H15N/c1-10-8-12-7-6-11-4-2-3-5-13(11)14(12)9-15-10/h6-9H,2-5H2,1H3 |
| InChIKey | WIJGOJRNXNTOIO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methyl-7,8,9,10-tetrahydrobenzo[h]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-7,8,9,10-tetrahydrobenzo[h]isoquinoline?
The IUPAC name of 3-methyl-7,8,9,10-tetrahydrobenzo[h]isoquinoline (CID 156549162) is 3-methyl-7,8,9,10-tetrahydrobenzo[h]isoquinoline.
What is the SMILES notation for 3-methyl-7,8,9,10-tetrahydrobenzo[h]isoquinoline?
The canonical SMILES for 3-methyl-7,8,9,10-tetrahydrobenzo[h]isoquinoline is Cc1cc2ccc3c(c2cn1)CCCC3.
What is the InChIKey of 3-methyl-7,8,9,10-tetrahydrobenzo[h]isoquinoline?
The InChIKey is WIJGOJRNXNTOIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N/c1-10-8-12-7-6-11-4-2-3-5-13(11)14(12)9-15-10/h6-9H,2-5H2,1H3.
What are the key properties of 3-methyl-7,8,9,10-tetrahydrobenzo[h]isoquinoline?
3-methyl-7,8,9,10-tetrahydrobenzo[h]isoquinoline has a molecular weight of 197.28 g/mol, XLogP of 3.42, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-7,8,9,10-tetrahydrobenzo[h]isoquinoline is sourced from PubChem (CID 156549162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).