C14H15N — CID 156549162
3-methyl-7,8,9,10-tetrahydrobenzo[h]isoquinoline (PubChem CID 156549162) has the molecular formula C14H15N and a molecular weight of 197.28 g/mol. Its IUPAC name is 3-methyl-7,8,9,10-tetrahydrobenzo[h]isoquinoline.
| Compound Name | 3-methyl-7,8,9,10-tetrahydrobenzo[h]isoquinoline |
|---|---|
| PubChem CID | 156549162 |
| Molecular Formula | C14H15N |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 3-methyl-7,8,9,10-tetrahydrobenzo[h]isoquinoline |
| SMILES | Cc1cc2ccc3c(c2cn1)CCCC3 |
| InChI | InChI=1S/C14H15N/c1-10-8-12-7-6-11-4-2-3-5-13(11)14(12)9-15-10/h6-9H,2-5H2,1H3 |
| InChIKey | WIJGOJRNXNTOIO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |