C56H50 — CID 161483265
2-methylphenanthrene;3-methylphenanthrene;9-methylphenanthrene;6-methyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 161483265) has the molecular formula C56H50 and a molecular weight of 723.02 g/mol. Its IUPAC name is 2-methylphenanthrene;3-methylphenanthrene;9-methylphenanthrene;6-methyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-methylphenanthrene;3-methylphenanthrene;9-methylphenanthrene;6-methyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 161483265 |
| Molecular Formula | C56H50 |
| Molecular Weight | 723.02 g/mol |
| Exact Mass | 722.39 |
| IUPAC Name | 2-methylphenanthrene;3-methylphenanthrene;9-methylphenanthrene;6-methyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | Cc1cc2ccccc2c2ccccc12.Cc1ccc2c(c1)CCCC2.Cc1ccc2c(ccc3ccccc32)c1.Cc1ccc2ccc3ccccc3c2c1 |
| InChI | InChI=1S/3C15H12.C11H14/c1-11-10-12-6-2-3-8-14(12)15-9-5-4-7-13(11)15;1-11-6-9-15-13(10-11)8-7-12-4-2-3-5-14(12)15;1-11-6-7-13-9-8-12-4-2-3-5-14(12)15(13)10-11;1-9-6-7-10-4-2-3-5-11(10)8-9/h3*2-10H,1H3;6-8H,2-5H2,1H3 |
| InChIKey | WEQIXLQABABMFH-UHFFFAOYSA-N |
| XLogP | 15.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.02 |
| LogP ≤ 5 | 15.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|