C15H20 — CID 91186069
ethane;1,3,6-trimethylnaphthalene (PubChem CID 91186069) has the molecular formula C15H20 and a molecular weight of 200.32 g/mol. Its IUPAC name is ethane;1,3,6-trimethylnaphthalene.
| Compound Name | ethane;1,3,6-trimethylnaphthalene |
|---|---|
| PubChem CID | 91186069 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | ethane;1,3,6-trimethylnaphthalene |
| SMILES | CC.Cc1ccc2c(C)cc(C)cc2c1 |
| InChI | InChI=1S/C13H14.C2H6/c1-9-4-5-13-11(3)6-10(2)8-12(13)7-9;1-2/h4-8H,1-3H3;1-2H3 |
| InChIKey | RXVQBYUSURWHJG-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |